C21H33N3O5S — CID 55986626
tert-butyl 4-[[3-[methyl(propan-2-yl)sulfamoyl]benzoyl]amino]piperidine-1-carboxylate (PubChem CID 55986626) has the molecular formula C21H33N3O5S and a molecular weight of 439.58 g/mol. Its IUPAC name is tert-butyl 4-[[3-[methyl(propan-2-yl)sulfamoyl]benzoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-[methyl(propan-2-yl)sulfamoyl]benzoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55986626 |
| Molecular Formula | C21H33N3O5S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | tert-butyl 4-[[3-[methyl(propan-2-yl)sulfamoyl]benzoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)N(C)S(=O)(=O)c1cccc(C(=O)NC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H33N3O5S/c1-15(2)23(6)30(27,28)18-9-7-8-16(14-18)19(25)22-17-10-12-24(13-11-17)20(26)29-21(3,4)5/h7-9,14-15,17H,10-13H2,1-6H3,(H,22,25) |
| InChIKey | FTQCIACLFOKUOG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |