C18H21BrF2N2O2S — CID 55988693
2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-1-[4-(difluoromethoxy)phenyl]ethanol (PubChem CID 55988693) has the molecular formula C18H21BrF2N2O2S and a molecular weight of 447.35 g/mol. Its IUPAC name is 2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-1-[4-(difluoromethoxy)phenyl]ethanol.
| Compound Name | 2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-1-[4-(difluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 55988693 |
| Molecular Formula | C18H21BrF2N2O2S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-1-[4-(difluoromethoxy)phenyl]ethanol |
| SMILES | OC(CN1CCN(Cc2ccc(Br)s2)CC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H21BrF2N2O2S/c19-17-6-5-15(26-17)11-22-7-9-23(10-8-22)12-16(24)13-1-3-14(4-2-13)25-18(20)21/h1-6,16,18,24H,7-12H2 |
| InChIKey | GZRMYVOTGATUIO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |