C24H28N4O4 — CID 55990474
[2-[4-(cyclopropylmethyl)piperazine-1-carbonyl]phenyl]-[4-(dimethylamino)-3-nitrophenyl]methanone (PubChem CID 55990474) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is [2-[4-(cyclopropylmethyl)piperazine-1-carbonyl]phenyl]-[4-(dimethylamino)-3-nitrophenyl]methanone.
| Compound Name | [2-[4-(cyclopropylmethyl)piperazine-1-carbonyl]phenyl]-[4-(dimethylamino)-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 55990474 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [2-[4-(cyclopropylmethyl)piperazine-1-carbonyl]phenyl]-[4-(dimethylamino)-3-nitrophenyl]methanone |
| SMILES | CN(C)c1ccc(C(=O)c2ccccc2C(=O)N2CCN(CC3CC3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H28N4O4/c1-25(2)21-10-9-18(15-22(21)28(31)32)23(29)19-5-3-4-6-20(19)24(30)27-13-11-26(12-14-27)16-17-7-8-17/h3-6,9-10,15,17H,7-8,11-14,16H2,1-2H3 |
| InChIKey | CXMVWGLTSBQWAX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|