C27H29N3O4 — CID 55991002
N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide (PubChem CID 55991002) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 55991002 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-1-(furan-2-carbonyl)piperidine-2-carboxamide |
| SMILES | CCN(C(=O)Cc1ccc(NC(=O)C2CCCCN2C(=O)c2ccco2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O4/c1-2-29(22-9-4-3-5-10-22)25(31)19-20-13-15-21(16-14-20)28-26(32)23-11-6-7-17-30(23)27(33)24-12-8-18-34-24/h3-5,8-10,12-16,18,23H,2,6-7,11,17,19H2,1H3,(H,28,32) |
| InChIKey | CRUCDXCAIASFKG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |