C19H25N3O4S — CID 55991190
N-[2-(3-ethynylanilino)-2-oxoethyl]-1-propylsulfonylpiperidine-2-carboxamide (PubChem CID 55991190) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[2-(3-ethynylanilino)-2-oxoethyl]-1-propylsulfonylpiperidine-2-carboxamide.
| Compound Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-1-propylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 55991190 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-1-propylsulfonylpiperidine-2-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)C2CCCCN2S(=O)(=O)CCC)c1 |
| InChI | InChI=1S/C19H25N3O4S/c1-3-12-27(25,26)22-11-6-5-10-17(22)19(24)20-14-18(23)21-16-9-7-8-15(4-2)13-16/h2,7-9,13,17H,3,5-6,10-12,14H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | NSCJRQKECMBLLT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|