C20H20ClFN2O3 — CID 55991203
N-(4-chlorophenyl)-4-[3-(3-fluoro-4-methoxyphenyl)prop-2-enoylamino]butanamide (PubChem CID 55991203) has the molecular formula C20H20ClFN2O3 and a molecular weight of 390.84 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[3-(3-fluoro-4-methoxyphenyl)prop-2-enoylamino]butanamide.
| Compound Name | N-(4-chlorophenyl)-4-[3-(3-fluoro-4-methoxyphenyl)prop-2-enoylamino]butanamide |
|---|---|
| PubChem CID | 55991203 |
| Molecular Formula | C20H20ClFN2O3 |
| Molecular Weight | 390.84 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-(4-chlorophenyl)-4-[3-(3-fluoro-4-methoxyphenyl)prop-2-enoylamino]butanamide |
| SMILES | COc1ccc(C=CC(=O)NCCCC(=O)Nc2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C20H20ClFN2O3/c1-27-18-10-4-14(13-17(18)22)5-11-19(25)23-12-2-3-20(26)24-16-8-6-15(21)7-9-16/h4-11,13H,2-3,12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | RSMPHWYDOSSYTL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|