C23H20BrN3O4 — CID 55993094
5-bromo-N-[2-[[3-(3-cyanopropoxy)phenyl]carbamoyl]phenyl]-N-methylfuran-2-carboxamide (PubChem CID 55993094) has the molecular formula C23H20BrN3O4 and a molecular weight of 482.33 g/mol. Its IUPAC name is 5-bromo-N-[2-[[3-(3-cyanopropoxy)phenyl]carbamoyl]phenyl]-N-methylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[[3-(3-cyanopropoxy)phenyl]carbamoyl]phenyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55993094 |
| Molecular Formula | C23H20BrN3O4 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 5-bromo-N-[2-[[3-(3-cyanopropoxy)phenyl]carbamoyl]phenyl]-N-methylfuran-2-carboxamide |
| SMILES | CN(C(=O)c1ccc(Br)o1)c1ccccc1C(=O)Nc1cccc(OCCCC#N)c1 |
| InChI | InChI=1S/C23H20BrN3O4/c1-27(23(29)20-11-12-21(24)31-20)19-10-3-2-9-18(19)22(28)26-16-7-6-8-17(15-16)30-14-5-4-13-25/h2-3,6-12,15H,4-5,14H2,1H3,(H,26,28) |
| InChIKey | ZTGZBDVLXLRYIX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|