C18H16ClIN2O3 — CID 55878842
5-chloro-N-[3-(3-cyanopropoxy)phenyl]-4-iodo-2-methoxybenzamide (PubChem CID 55878842) has the molecular formula C18H16ClIN2O3 and a molecular weight of 470.69 g/mol. Its IUPAC name is 5-chloro-N-[3-(3-cyanopropoxy)phenyl]-4-iodo-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[3-(3-cyanopropoxy)phenyl]-4-iodo-2-methoxybenzamide |
|---|---|
| PubChem CID | 55878842 |
| Molecular Formula | C18H16ClIN2O3 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | 5-chloro-N-[3-(3-cyanopropoxy)phenyl]-4-iodo-2-methoxybenzamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)Nc1cccc(OCCCC#N)c1 |
| InChI | InChI=1S/C18H16ClIN2O3/c1-24-17-11-16(20)15(19)10-14(17)18(23)22-12-5-4-6-13(9-12)25-8-3-2-7-21/h4-6,9-11H,2-3,8H2,1H3,(H,22,23) |
| InChIKey | BVEXECKTDAXNSY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|