C18H18FN3O5S2 — CID 55994086
[2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (E)-3-(1,3-thiazol-2-yl)prop-2-enoate (PubChem CID 55994086) has the molecular formula C18H18FN3O5S2 and a molecular weight of 439.49 g/mol. Its IUPAC name is [2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (E)-3-(1,3-thiazol-2-yl)prop-2-enoate.
| Compound Name | [2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (E)-3-(1,3-thiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55994086 |
| Molecular Formula | C18H18FN3O5S2 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | [2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (E)-3-(1,3-thiazol-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1nccs1)OCC(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H18FN3O5S2/c19-14-1-3-15(4-2-14)29(25,26)22-10-8-21(9-11-22)17(23)13-27-18(24)6-5-16-20-7-12-28-16/h1-7,12H,8-11,13H2/b6-5+ |
| InChIKey | UFRWFHWNFJQJQI-AATRIKPKSA-N |
| XLogP | 1.37 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|