C20H26N2O6S — CID 9230785
[2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 9230785) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is [2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 9230785 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | [2-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OCC(=O)N1CCN(S(=O)(=O)c2ccc(OCC)cc2)CC1 |
| InChI | InChI=1S/C20H26N2O6S/c1-3-5-6-7-20(24)28-16-19(23)21-12-14-22(15-13-21)29(25,26)18-10-8-17(9-11-18)27-4-2/h3,5-11H,4,12-16H2,1-2H3/b5-3+,7-6+ |
| InChIKey | PEHCBXFYAHZKDG-TWTPFVCWSA-N |
| XLogP | 1.59 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|