C16H19FN6O3S2 — CID 55997543
1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylethanone (PubChem CID 55997543) has the molecular formula C16H19FN6O3S2 and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylethanone.
| Compound Name | 1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylethanone |
|---|---|
| PubChem CID | 55997543 |
| Molecular Formula | C16H19FN6O3S2 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylethanone |
| SMILES | C=CCn1nnnc1SCC(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H19FN6O3S2/c1-2-7-23-16(18-19-20-23)27-12-15(24)21-8-10-22(11-9-21)28(25,26)14-5-3-13(17)4-6-14/h2-6H,1,7-12H2 |
| InChIKey | QUFJUIGLSHNSNE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|