C18H18ClN3O3 — CID 55999052
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-chloroquinoline-6-carboxylate (PubChem CID 55999052) has the molecular formula C18H18ClN3O3 and a molecular weight of 359.81 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-chloroquinoline-6-carboxylate.
| Compound Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55999052 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 2-chloroquinoline-6-carboxylate |
| SMILES | CC(OC(=O)c1ccc2nc(Cl)ccc2c1)c1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C18H18ClN3O3/c1-10(15-21-17(22-25-15)18(2,3)4)24-16(23)12-5-7-13-11(9-12)6-8-14(19)20-13/h5-10H,1-4H3 |
| InChIKey | PXCKWGSUDVMYKU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|