C23H21F2NO4 — CID 561349
N-[2-[2,5-difluoro-3,4-bis(phenylmethoxy)phenyl]-2-hydroxyethyl]formamide (PubChem CID 561349) has the molecular formula C23H21F2NO4 and a molecular weight of 413.42 g/mol. Its IUPAC name is N-[2-[2,5-difluoro-3,4-bis(phenylmethoxy)phenyl]-2-hydroxyethyl]formamide.
| Compound Name | N-[2-[2,5-difluoro-3,4-bis(phenylmethoxy)phenyl]-2-hydroxyethyl]formamide |
|---|---|
| PubChem CID | 561349 |
| Molecular Formula | C23H21F2NO4 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[2-[2,5-difluoro-3,4-bis(phenylmethoxy)phenyl]-2-hydroxyethyl]formamide |
| SMILES | O=CNCC(O)c1cc(F)c(OCc2ccccc2)c(OCc2ccccc2)c1F |
| InChI | InChI=1S/C23H21F2NO4/c24-19-11-18(20(28)12-26-15-27)21(25)23(30-14-17-9-5-2-6-10-17)22(19)29-13-16-7-3-1-4-8-16/h1-11,15,20,28H,12-14H2,(H,26,27) |
| InChIKey | JAJOIXIKMZBHRV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|