C13H12F3N3S — CID 562668
N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)ethanimidamide (PubChem CID 562668) has the molecular formula C13H12F3N3S and a molecular weight of 299.32 g/mol. Its IUPAC name is N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)ethanimidamide.
| Compound Name | N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)ethanimidamide |
|---|---|
| PubChem CID | 562668 |
| Molecular Formula | C13H12F3N3S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)ethanimidamide |
| SMILES | CC(N)=NC(SCc1ccccc1)=C(C#N)C(F)(F)F |
| InChI | InChI=1S/C13H12F3N3S/c1-9(18)19-12(11(7-17)13(14,15)16)20-8-10-5-3-2-4-6-10/h2-6H,8H2,1H3,(H2,18,19) |
| InChIKey | BTVUYJYNKPMMDB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|