C10H11F2N3S — CID 90973033
(2,6-difluorophenyl)methyl N-(1-aminoethylidene)carbamimidothioate (PubChem CID 90973033) has the molecular formula C10H11F2N3S and a molecular weight of 243.28 g/mol. Its IUPAC name is (2,6-difluorophenyl)methyl N-(1-aminoethylidene)carbamimidothioate.
| Compound Name | (2,6-difluorophenyl)methyl N-(1-aminoethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 90973033 |
| Molecular Formula | C10H11F2N3S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | (2,6-difluorophenyl)methyl N-(1-aminoethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(C)N)SCc1c(F)cccc1F |
| InChI | InChI=1S/C10H11F2N3S/c1-6(13)15-10(14)16-5-7-8(11)3-2-4-9(7)12/h2-4H,5H2,1H3,(H3,13,14,15) |
| InChIKey | GJCXSBGBXVELDZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|