C13H9F6N3S — CID 561482
N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)-2,2,2-trifluoroethanimidamide (PubChem CID 561482) has the molecular formula C13H9F6N3S and a molecular weight of 353.29 g/mol. Its IUPAC name is N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 561482 |
| Molecular Formula | C13H9F6N3S |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)-2,2,2-trifluoroethanimidamide |
| SMILES | N#CC(=C(N=C(N)C(F)(F)F)SCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H9F6N3S/c14-12(15,16)9(6-20)10(22-11(21)13(17,18)19)23-7-8-4-2-1-3-5-8/h1-5H,7H2,(H2,21,22) |
| InChIKey | ATWVFNYZCSJTPQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|