C18H14F3N3S — CID 568877
N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)benzenecarboximidamide (PubChem CID 568877) has the molecular formula C18H14F3N3S and a molecular weight of 361.39 g/mol. Its IUPAC name is N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)benzenecarboximidamide.
| Compound Name | N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 568877 |
| Molecular Formula | C18H14F3N3S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N'-(1-benzylsulfanyl-2-cyano-3,3,3-trifluoroprop-1-enyl)benzenecarboximidamide |
| SMILES | N#CC(=C(N=C(N)c1ccccc1)SCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H14F3N3S/c19-18(20,21)15(11-22)17(25-12-13-7-3-1-4-8-13)24-16(23)14-9-5-2-6-10-14/h1-10H,12H2,(H2,23,24) |
| InChIKey | OLPYPYMUUXWOAF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|