C29H38O3S — CID 564161
(3-benzylsulfanyl-5,10,13-trimethyl-4-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate (PubChem CID 564161) has the molecular formula C29H38O3S and a molecular weight of 466.69 g/mol. Its IUPAC name is (3-benzylsulfanyl-5,10,13-trimethyl-4-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate.
| Compound Name | (3-benzylsulfanyl-5,10,13-trimethyl-4-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate |
|---|---|
| PubChem CID | 564161 |
| Molecular Formula | C29H38O3S |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (3-benzylsulfanyl-5,10,13-trimethyl-4-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate |
| SMILES | CC(=O)OC1CCC2C3CCC4(C)C(=O)C(SCc5ccccc5)=CCC4(C)C3CCC12C |
| InChI | InChI=1S/C29H38O3S/c1-19(30)32-25-11-10-22-21-12-16-29(4)26(31)24(33-18-20-8-6-5-7-9-20)14-17-28(29,3)23(21)13-15-27(22,25)2/h5-9,14,21-23,25H,10-13,15-18H2,1-4H3 |
| InChIKey | ZUYOXNCABKZXMW-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |