C22H33N3O4 — CID 56500816
N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-2-[2-(1,3-dioxolan-2-yl)piperidin-1-yl]acetamide (PubChem CID 56500816) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-2-[2-(1,3-dioxolan-2-yl)piperidin-1-yl]acetamide.
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-2-[2-(1,3-dioxolan-2-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 56500816 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-2-[2-(1,3-dioxolan-2-yl)piperidin-1-yl]acetamide |
| SMILES | CC1CN(c2ccc(NC(=O)CN3CCCCC3C3OCCO3)cc2)CC(C)O1 |
| InChI | InChI=1S/C22H33N3O4/c1-16-13-25(14-17(2)29-16)19-8-6-18(7-9-19)23-21(26)15-24-10-4-3-5-20(24)22-27-11-12-28-22/h6-9,16-17,20,22H,3-5,10-15H2,1-2H3,(H,23,26) |
| InChIKey | LCWMKMUYPPYCOP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|