C13H8Cl2F3N3O3S — CID 56502448
N-(4-amino-3,5-dichlorophenyl)-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide (PubChem CID 56502448) has the molecular formula C13H8Cl2F3N3O3S and a molecular weight of 414.19 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56502448 |
| Molecular Formula | C13H8Cl2F3N3O3S |
| Molecular Weight | 414.19 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-(trifluoromethylsulfonyl)pyridine-3-carboxamide |
| SMILES | Nc1c(Cl)cc(NC(=O)c2cccnc2S(=O)(=O)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H8Cl2F3N3O3S/c14-8-4-6(5-9(15)10(8)19)21-11(22)7-2-1-3-20-12(7)25(23,24)13(16,17)18/h1-5H,19H2,(H,21,22) |
| InChIKey | APYKJGTZHCXZQU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|