C24H30N4O6 — CID 56502479
N'-[2-(2,4-dimethylanilino)acetyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carbohydrazide (PubChem CID 56502479) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is N'-[2-(2,4-dimethylanilino)acetyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carbohydrazide.
| Compound Name | N'-[2-(2,4-dimethylanilino)acetyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 56502479 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N'-[2-(2,4-dimethylanilino)acetyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carbohydrazide |
| SMILES | COc1cc(N2CC(C(=O)NNC(=O)CNc3ccc(C)cc3C)CC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H30N4O6/c1-14-6-7-18(15(2)8-14)25-12-21(29)26-27-24(31)16-9-22(30)28(13-16)17-10-19(32-3)23(34-5)20(11-17)33-4/h6-8,10-11,16,25H,9,12-13H2,1-5H3,(H,26,29)(H,27,31) |
| InChIKey | SCAKMGSQAYJCKU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|