C20H23N5O3S — CID 56502481
N'-[2-(2,4-dimethylanilino)acetyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanehydrazide (PubChem CID 56502481) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is N'-[2-(2,4-dimethylanilino)acetyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanehydrazide.
| Compound Name | N'-[2-(2,4-dimethylanilino)acetyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanehydrazide |
|---|---|
| PubChem CID | 56502481 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N'-[2-(2,4-dimethylanilino)acetyl]-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanehydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)CCCc2nc(-c3cccs3)no2)c(C)c1 |
| InChI | InChI=1S/C20H23N5O3S/c1-13-8-9-15(14(2)11-13)21-12-18(27)24-23-17(26)6-3-7-19-22-20(25-28-19)16-5-4-10-29-16/h4-5,8-11,21H,3,6-7,12H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | IMUZOODQCGURDT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|