C22H24FN5O3 — CID 56503123
N'-[2-(2,4-dimethylanilino)acetyl]-3-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanehydrazide (PubChem CID 56503123) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is N'-[2-(2,4-dimethylanilino)acetyl]-3-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanehydrazide.
| Compound Name | N'-[2-(2,4-dimethylanilino)acetyl]-3-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanehydrazide |
|---|---|
| PubChem CID | 56503123 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | N'-[2-(2,4-dimethylanilino)acetyl]-3-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanehydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)CCc2nc(-c3ccc(C)c(F)c3)no2)c(C)c1 |
| InChI | InChI=1S/C22H24FN5O3/c1-13-4-7-18(15(3)10-13)24-12-20(30)27-26-19(29)8-9-21-25-22(28-31-21)16-6-5-14(2)17(23)11-16/h4-7,10-11,24H,8-9,12H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | IEWDDETYRRDUES-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|