C18H18N4O2S2 — CID 55439956
N'-[2-(2,4-dimethylanilino)acetyl]-2-thiophen-2-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 55439956) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N'-[2-(2,4-dimethylanilino)acetyl]-2-thiophen-2-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-[2-(2,4-dimethylanilino)acetyl]-2-thiophen-2-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55439956 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N'-[2-(2,4-dimethylanilino)acetyl]-2-thiophen-2-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2csc(-c3cccs3)n2)c(C)c1 |
| InChI | InChI=1S/C18H18N4O2S2/c1-11-5-6-13(12(2)8-11)19-9-16(23)21-22-17(24)14-10-26-18(20-14)15-4-3-7-25-15/h3-8,10,19H,9H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | SVCYKEPWXROGTO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|