C22H24N4O2S — CID 56504272
2-(2-benzyl-1,3-thiazol-4-yl)-N'-[2-(2,4-dimethylanilino)acetyl]acetohydrazide (PubChem CID 56504272) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-thiazol-4-yl)-N'-[2-(2,4-dimethylanilino)acetyl]acetohydrazide.
| Compound Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N'-[2-(2,4-dimethylanilino)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 56504272 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N'-[2-(2,4-dimethylanilino)acetyl]acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)Cc2csc(Cc3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C22H24N4O2S/c1-15-8-9-19(16(2)10-15)23-13-21(28)26-25-20(27)12-18-14-29-22(24-18)11-17-6-4-3-5-7-17/h3-10,14,23H,11-13H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | IRMKSTXSYJOGJN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|