C21H23N3O5S2 — CID 26738509
2-thiophen-2-yl-N'-(3,4,5-triethoxybenzoyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 26738509) has the molecular formula C21H23N3O5S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-thiophen-2-yl-N'-(3,4,5-triethoxybenzoyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-thiophen-2-yl-N'-(3,4,5-triethoxybenzoyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 26738509 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 2-thiophen-2-yl-N'-(3,4,5-triethoxybenzoyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2csc(-c3cccs3)n2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H23N3O5S2/c1-4-27-15-10-13(11-16(28-5-2)18(15)29-6-3)19(25)23-24-20(26)14-12-31-21(22-14)17-8-7-9-30-17/h7-12H,4-6H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | QTWUKLMJGVTUJI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|