C19H18Cl2N4O3 — CID 56505008
N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)acetamide (PubChem CID 56505008) has the molecular formula C19H18Cl2N4O3 and a molecular weight of 421.28 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)acetamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 56505008 |
| Molecular Formula | C19H18Cl2N4O3 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-(4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl)acetamide |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)CN1C(=O)NC(C)(c2ccccn2)C1=O |
| InChI | InChI=1S/C19H18Cl2N4O3/c1-19(15-5-3-4-8-22-15)17(27)25(18(28)23-19)11-16(26)24(2)10-12-6-7-13(20)14(21)9-12/h3-9H,10-11H2,1-2H3,(H,23,28) |
| InChIKey | PWJNBNJFLZAVAC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|