C27H34N2O4 — CID 56505177
N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56505177) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56505177 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | COc1cc(C(C)NC(=O)C(c2ccccc2)N2CCCCC2=O)ccc1OC1CCCC1 |
| InChI | InChI=1S/C27H34N2O4/c1-19(21-15-16-23(24(18-21)32-2)33-22-12-6-7-13-22)28-27(31)26(20-10-4-3-5-11-20)29-17-9-8-14-25(29)30/h3-5,10-11,15-16,18-19,22,26H,6-9,12-14,17H2,1-2H3,(H,28,31) |
| InChIKey | QQQLYPKJOVUIGH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |