C22H22F3NO5 — CID 56507766
methyl 2-[(3,5-dimethoxyphenyl)methyl-[(Z)-4,4,4-trifluoro-3-phenylbut-2-enoyl]amino]acetate (PubChem CID 56507766) has the molecular formula C22H22F3NO5 and a molecular weight of 437.41 g/mol. Its IUPAC name is methyl 2-[(3,5-dimethoxyphenyl)methyl-[(Z)-4,4,4-trifluoro-3-phenylbut-2-enoyl]amino]acetate.
| Compound Name | methyl 2-[(3,5-dimethoxyphenyl)methyl-[(Z)-4,4,4-trifluoro-3-phenylbut-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 56507766 |
| Molecular Formula | C22H22F3NO5 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | methyl 2-[(3,5-dimethoxyphenyl)methyl-[(Z)-4,4,4-trifluoro-3-phenylbut-2-enoyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1cc(OC)cc(OC)c1)C(=O)/C=C(/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H22F3NO5/c1-29-17-9-15(10-18(11-17)30-2)13-26(14-21(28)31-3)20(27)12-19(22(23,24)25)16-7-5-4-6-8-16/h4-12H,13-14H2,1-3H3/b19-12- |
| InChIKey | FUHMLCQFZVJJOO-UNOMPAQXSA-N |
| XLogP | 3.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|