C18H19F3N4O3S — CID 56510813
4-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]benzenesulfonamide (PubChem CID 56510813) has the molecular formula C18H19F3N4O3S and a molecular weight of 428.44 g/mol. Its IUPAC name is 4-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56510813 |
| Molecular Formula | C18H19F3N4O3S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 4-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CC(=O)N2CCN(c3ccc(C(F)(F)F)cn3)CC2)cc1 |
| InChI | InChI=1S/C18H19F3N4O3S/c19-18(20,21)14-3-6-16(23-12-14)24-7-9-25(10-8-24)17(26)11-13-1-4-15(5-2-13)29(22,27)28/h1-6,12H,7-11H2,(H2,22,27,28) |
| InChIKey | CVGSOGWKZWQXNH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |