C25H30ClN3O3 — CID 56512944
N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56512944) has the molecular formula C25H30ClN3O3 and a molecular weight of 455.99 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56512944 |
| Molecular Formula | C25H30ClN3O3 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | O=C(NCC(c1ccc(Cl)cc1)N1CCOCC1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C25H30ClN3O3/c26-21-11-9-19(10-12-21)22(28-14-16-32-17-15-28)18-27-25(31)24(20-6-2-1-3-7-20)29-13-5-4-8-23(29)30/h1-3,6-7,9-12,22,24H,4-5,8,13-18H2,(H,27,31) |
| InChIKey | PFADPSSJMXPUHD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |