C23H33N3O4 — CID 56514384
N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56514384) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56514384 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | O=C(NCC(C1CCOC1)N1CCOCC1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C23H33N3O4/c27-21-8-4-5-10-26(21)22(18-6-2-1-3-7-18)23(28)24-16-20(19-9-13-30-17-19)25-11-14-29-15-12-25/h1-3,6-7,19-20,22H,4-5,8-17H2,(H,24,28) |
| InChIKey | RZHPBDUFFBYASK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |