C25H28FN3O3 — CID 56513063
N'-(2-cyanoethyl)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-N'-phenylbutanediamide (PubChem CID 56513063) has the molecular formula C25H28FN3O3 and a molecular weight of 437.52 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56513063 |
| Molecular Formula | C25H28FN3O3 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)NCC1(c2cccc(F)c2)CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C25H28FN3O3/c26-21-7-4-6-20(18-21)25(12-16-32-17-13-25)19-28-23(30)10-11-24(31)29(15-5-14-27)22-8-2-1-3-9-22/h1-4,6-9,18H,5,10-13,15-17,19H2,(H,28,30) |
| InChIKey | LEUIWCZRBBDQFH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |