C25H34N4O4 — CID 56513587
tert-butyl 4-[2-[(3-morpholin-4-ylphenyl)carbamoyl]pyrrol-1-yl]piperidine-1-carboxylate (PubChem CID 56513587) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is tert-butyl 4-[2-[(3-morpholin-4-ylphenyl)carbamoyl]pyrrol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(3-morpholin-4-ylphenyl)carbamoyl]pyrrol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56513587 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | tert-butyl 4-[2-[(3-morpholin-4-ylphenyl)carbamoyl]pyrrol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cccc2C(=O)Nc2cccc(N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C25H34N4O4/c1-25(2,3)33-24(31)28-12-9-20(10-13-28)29-11-5-8-22(29)23(30)26-19-6-4-7-21(18-19)27-14-16-32-17-15-27/h4-8,11,18,20H,9-10,12-17H2,1-3H3,(H,26,30) |
| InChIKey | FGDDIUHHEGCZLQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |