C19H31N3O5S — CID 56580959
tert-butyl 4-[2-(2-ethylsulfonylethylcarbamoyl)pyrrol-1-yl]piperidine-1-carboxylate (PubChem CID 56580959) has the molecular formula C19H31N3O5S and a molecular weight of 413.54 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-ethylsulfonylethylcarbamoyl)pyrrol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-ethylsulfonylethylcarbamoyl)pyrrol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56580959 |
| Molecular Formula | C19H31N3O5S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | tert-butyl 4-[2-(2-ethylsulfonylethylcarbamoyl)pyrrol-1-yl]piperidine-1-carboxylate |
| SMILES | CCS(=O)(=O)CCNC(=O)c1cccn1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H31N3O5S/c1-5-28(25,26)14-10-20-17(23)16-7-6-11-22(16)15-8-12-21(13-9-15)18(24)27-19(2,3)4/h6-7,11,15H,5,8-10,12-14H2,1-4H3,(H,20,23) |
| InChIKey | YGCNSOMZYBTRTG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |