C24H33N3O5 — CID 56538766
tert-butyl 4-[2-[2-(2-methoxyphenoxy)ethylcarbamoyl]pyrrol-1-yl]piperidine-1-carboxylate (PubChem CID 56538766) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-(2-methoxyphenoxy)ethylcarbamoyl]pyrrol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-(2-methoxyphenoxy)ethylcarbamoyl]pyrrol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56538766 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | tert-butyl 4-[2-[2-(2-methoxyphenoxy)ethylcarbamoyl]pyrrol-1-yl]piperidine-1-carboxylate |
| SMILES | COc1ccccc1OCCNC(=O)c1cccn1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H33N3O5/c1-24(2,3)32-23(29)26-15-11-18(12-16-26)27-14-7-8-19(27)22(28)25-13-17-31-21-10-6-5-9-20(21)30-4/h5-10,14,18H,11-13,15-17H2,1-4H3,(H,25,28) |
| InChIKey | DACGATYAVVJXGG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|