C23H31N3O4 — CID 56580198
tert-butyl 4-[2-[(4-methoxy-3-methylphenyl)carbamoyl]pyrrol-1-yl]piperidine-1-carboxylate (PubChem CID 56580198) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4-methoxy-3-methylphenyl)carbamoyl]pyrrol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(4-methoxy-3-methylphenyl)carbamoyl]pyrrol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56580198 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | tert-butyl 4-[2-[(4-methoxy-3-methylphenyl)carbamoyl]pyrrol-1-yl]piperidine-1-carboxylate |
| SMILES | COc1ccc(NC(=O)c2cccn2C2CCN(C(=O)OC(C)(C)C)CC2)cc1C |
| InChI | InChI=1S/C23H31N3O4/c1-16-15-17(8-9-20(16)29-5)24-21(27)19-7-6-12-26(19)18-10-13-25(14-11-18)22(28)30-23(2,3)4/h6-9,12,15,18H,10-11,13-14H2,1-5H3,(H,24,27) |
| InChIKey | FGRHQFAHDHOULB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |