C25H21N3O2S — CID 56521223
1-[2-[2,5-dimethyl-1-(3-methylsulfanylphenyl)pyrrol-3-yl]-2-oxoethyl]-4-oxoquinoline-3-carbonitrile (PubChem CID 56521223) has the molecular formula C25H21N3O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is 1-[2-[2,5-dimethyl-1-(3-methylsulfanylphenyl)pyrrol-3-yl]-2-oxoethyl]-4-oxoquinoline-3-carbonitrile.
| Compound Name | 1-[2-[2,5-dimethyl-1-(3-methylsulfanylphenyl)pyrrol-3-yl]-2-oxoethyl]-4-oxoquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 56521223 |
| Molecular Formula | C25H21N3O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-[2-[2,5-dimethyl-1-(3-methylsulfanylphenyl)pyrrol-3-yl]-2-oxoethyl]-4-oxoquinoline-3-carbonitrile |
| SMILES | CSc1cccc(-n2c(C)cc(C(=O)Cn3cc(C#N)c(=O)c4ccccc43)c2C)c1 |
| InChI | InChI=1S/C25H21N3O2S/c1-16-11-22(17(2)28(16)19-7-6-8-20(12-19)31-3)24(29)15-27-14-18(13-26)25(30)21-9-4-5-10-23(21)27/h4-12,14H,15H2,1-3H3 |
| InChIKey | SPEWYBKZLQFITM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|