C24H25N3O3S — CID 56521653
1-[4-(3-ethoxy-5-phenylthiophene-2-carbonyl)piperazin-1-yl]-2-pyridin-2-ylethanone (PubChem CID 56521653) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-[4-(3-ethoxy-5-phenylthiophene-2-carbonyl)piperazin-1-yl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[4-(3-ethoxy-5-phenylthiophene-2-carbonyl)piperazin-1-yl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 56521653 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-[4-(3-ethoxy-5-phenylthiophene-2-carbonyl)piperazin-1-yl]-2-pyridin-2-ylethanone |
| SMILES | CCOc1cc(-c2ccccc2)sc1C(=O)N1CCN(C(=O)Cc2ccccn2)CC1 |
| InChI | InChI=1S/C24H25N3O3S/c1-2-30-20-17-21(18-8-4-3-5-9-18)31-23(20)24(29)27-14-12-26(13-15-27)22(28)16-19-10-6-7-11-25-19/h3-11,17H,2,12-16H2,1H3 |
| InChIKey | YDPRDLZFXFECPW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |