C23H27N5O2S — CID 55930778
3-ethoxy-5-phenyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]thiophene-2-carboxamide (PubChem CID 55930778) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 3-ethoxy-5-phenyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | 3-ethoxy-5-phenyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55930778 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 3-ethoxy-5-phenyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]thiophene-2-carboxamide |
| SMILES | CCOc1cc(-c2ccccc2)sc1C(=O)NCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C23H27N5O2S/c1-2-30-19-17-20(18-7-4-3-5-8-18)31-21(19)22(29)24-11-12-27-13-15-28(16-14-27)23-25-9-6-10-26-23/h3-10,17H,2,11-16H2,1H3,(H,24,29) |
| InChIKey | JXONLTGBYWAOPI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |