C20H23N3O4S — CID 56522221
5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[2-(3-methylbutyl)-1,3-thiazol-4-yl]methyl]imidazolidine-2,4-dione (PubChem CID 56522221) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[2-(3-methylbutyl)-1,3-thiazol-4-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[2-(3-methylbutyl)-1,3-thiazol-4-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56522221 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[2-(3-methylbutyl)-1,3-thiazol-4-yl]methyl]imidazolidine-2,4-dione |
| SMILES | CC(C)CCc1nc(CN2C(=O)NC(C)(c3ccc4c(c3)OCO4)C2=O)cs1 |
| InChI | InChI=1S/C20H23N3O4S/c1-12(2)4-7-17-21-14(10-28-17)9-23-18(24)20(3,22-19(23)25)13-5-6-15-16(8-13)27-11-26-15/h5-6,8,10,12H,4,7,9,11H2,1-3H3,(H,22,25) |
| InChIKey | PHHQVCZIUUDKJF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|