C23H28N8O2 — CID 56523114
1-[3-methyl-1-oxo-1-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]butan-2-yl]-3-phenylurea (PubChem CID 56523114) has the molecular formula C23H28N8O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-[3-methyl-1-oxo-1-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]butan-2-yl]-3-phenylurea.
| Compound Name | 1-[3-methyl-1-oxo-1-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]butan-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 56523114 |
| Molecular Formula | C23H28N8O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-[3-methyl-1-oxo-1-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]butan-2-yl]-3-phenylurea |
| SMILES | CC(C)C(NC(=O)Nc1ccccc1)C(=O)N1CCN(c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N8O2/c1-17(2)20(25-22(33)24-18-9-5-3-6-10-18)21(32)29-13-15-30(16-14-29)23-26-27-28-31(23)19-11-7-4-8-12-19/h3-12,17,20H,13-16H2,1-2H3,(H2,24,25,33) |
| InChIKey | WCXXLUIUCJEJEM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |