C23H22N6O3 — CID 56524180
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-oxoacetamide (PubChem CID 56524180) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-oxoacetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 56524180 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-oxoacetamide |
| SMILES | COc1ccc(-c2n[nH]c(CNC(=O)C(=O)c3c(C)nn(-c4ccccc4)c3C)n2)cc1 |
| InChI | InChI=1S/C23H22N6O3/c1-14-20(15(2)29(28-14)17-7-5-4-6-8-17)21(30)23(31)24-13-19-25-22(27-26-19)16-9-11-18(32-3)12-10-16/h4-12H,13H2,1-3H3,(H,24,31)(H,25,26,27) |
| InChIKey | YODJCOVTNLHSTO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|