C19H19FN2 — CID 56525604
4-[[(3-fluorophenyl)methyl-(2-methylprop-2-enyl)amino]methyl]benzonitrile (PubChem CID 56525604) has the molecular formula C19H19FN2 and a molecular weight of 294.37 g/mol. Its IUPAC name is 4-[[(3-fluorophenyl)methyl-(2-methylprop-2-enyl)amino]methyl]benzonitrile.
| Compound Name | 4-[[(3-fluorophenyl)methyl-(2-methylprop-2-enyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 56525604 |
| Molecular Formula | C19H19FN2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-[[(3-fluorophenyl)methyl-(2-methylprop-2-enyl)amino]methyl]benzonitrile |
| SMILES | C=C(C)CN(Cc1ccc(C#N)cc1)Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H19FN2/c1-15(2)12-22(14-18-4-3-5-19(20)10-18)13-17-8-6-16(11-21)7-9-17/h3-10H,1,12-14H2,2H3 |
| InChIKey | RZEPACOUMAGPHV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|