C21H24N4O4S — CID 56528409
[3-(propylcarbamoylamino)phenyl] 3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate (PubChem CID 56528409) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is [3-(propylcarbamoylamino)phenyl] 3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate.
| Compound Name | [3-(propylcarbamoylamino)phenyl] 3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate |
|---|---|
| PubChem CID | 56528409 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [3-(propylcarbamoylamino)phenyl] 3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate |
| SMILES | CCCNC(=O)Nc1cccc(OC(=O)CCn2cnc3sc(C)c(C)c3c2=O)c1 |
| InChI | InChI=1S/C21H24N4O4S/c1-4-9-22-21(28)24-15-6-5-7-16(11-15)29-17(26)8-10-25-12-23-19-18(20(25)27)13(2)14(3)30-19/h5-7,11-12H,4,8-10H2,1-3H3,(H2,22,24,28) |
| InChIKey | BLNYDQBIPOINMR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|