C19H17F3N2O4S — CID 86884808
[2-(2,2,2-trifluoroethoxy)phenyl] 3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate (PubChem CID 86884808) has the molecular formula C19H17F3N2O4S and a molecular weight of 426.42 g/mol. Its IUPAC name is [2-(2,2,2-trifluoroethoxy)phenyl] 3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate.
| Compound Name | [2-(2,2,2-trifluoroethoxy)phenyl] 3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate |
|---|---|
| PubChem CID | 86884808 |
| Molecular Formula | C19H17F3N2O4S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | [2-(2,2,2-trifluoroethoxy)phenyl] 3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoate |
| SMILES | Cc1sc2ncn(CCC(=O)Oc3ccccc3OCC(F)(F)F)c(=O)c2c1C |
| InChI | InChI=1S/C19H17F3N2O4S/c1-11-12(2)29-17-16(11)18(26)24(10-23-17)8-7-15(25)28-14-6-4-3-5-13(14)27-9-19(20,21)22/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | VAGNKGIPUINTEV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|