C19H18N2O5S — CID 16616473
methyl 4-[3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoyloxy]benzoate (PubChem CID 16616473) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is methyl 4-[3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoyloxy]benzoate.
| Compound Name | methyl 4-[3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoyloxy]benzoate |
|---|---|
| PubChem CID | 16616473 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | methyl 4-[3-(5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)propanoyloxy]benzoate |
| SMILES | COC(=O)c1ccc(OC(=O)CCn2cnc3sc(C)c(C)c3c2=O)cc1 |
| InChI | InChI=1S/C19H18N2O5S/c1-11-12(2)27-17-16(11)18(23)21(10-20-17)9-8-15(22)26-14-6-4-13(5-7-14)19(24)25-3/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | GTNDOTIXGOCFHZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|