C19H22N2O2S — CID 7731373
5,6-dimethyl-3-[4-(4-methylphenoxy)butyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 7731373) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 5,6-dimethyl-3-[4-(4-methylphenoxy)butyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-3-[4-(4-methylphenoxy)butyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7731373 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 5,6-dimethyl-3-[4-(4-methylphenoxy)butyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(OCCCCn2cnc3sc(C)c(C)c3c2=O)cc1 |
| InChI | InChI=1S/C19H22N2O2S/c1-13-6-8-16(9-7-13)23-11-5-4-10-21-12-20-18-17(19(21)22)14(2)15(3)24-18/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | HTOFIEPEEANYFE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|