C24H24N4O3S — CID 56530036
N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide (PubChem CID 56530036) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide.
| Compound Name | N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
|---|---|
| PubChem CID | 56530036 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
| SMILES | CCc1ccc(-c2cc(NC(=O)c3sc4nc5n(c(=O)c4c3C)CCCCC5)on2)cc1 |
| InChI | InChI=1S/C24H24N4O3S/c1-3-15-8-10-16(11-9-15)17-13-19(31-27-17)26-22(29)21-14(2)20-23(32-21)25-18-7-5-4-6-12-28(18)24(20)30/h8-11,13H,3-7,12H2,1-2H3,(H,26,29) |
| InChIKey | YORDLZVHWGJHPE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |