C22H18F2N4O2S2 — CID 29447903
N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide (PubChem CID 29447903) has the molecular formula C22H18F2N4O2S2 and a molecular weight of 472.54 g/mol. Its IUPAC name is N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide.
| Compound Name | N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
|---|---|
| PubChem CID | 29447903 |
| Molecular Formula | C22H18F2N4O2S2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
| SMILES | Cc1c(C(=O)Nc2nc(-c3cc(F)ccc3F)cs2)sc2nc3n(c(=O)c12)CCCCC3 |
| InChI | InChI=1S/C22H18F2N4O2S2/c1-11-17-20(26-16-5-3-2-4-8-28(16)21(17)30)32-18(11)19(29)27-22-25-15(10-31-22)13-9-12(23)6-7-14(13)24/h6-7,9-10H,2-5,8H2,1H3,(H,25,27,29) |
| InChIKey | OWGOXMOVWCFSGV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |